C40H66N2O9S2 — CID 169235723
[2,3-dimethyl-4-(2-methylhexan-2-yloxy)butan-2-yl] N-(4-methylphenyl)sulfonylcarbamate;2,2,4,4,5-pentamethylhexyl N-(4-methylphenyl)sulfonylcarbamate (PubChem CID 169235723) has the molecular formula C40H66N2O9S2 and a molecular weight of 783.11 g/mol. Its IUPAC name is [2,3-dimethyl-4-(2-methylhexan-2-yloxy)butan-2-yl] N-(4-methylphenyl)sulfonylcarbamate;2,2,4,4,5-pentamethylhexyl N-(4-methylphenyl)sulfonylcarbamate.
| Compound Name | [2,3-dimethyl-4-(2-methylhexan-2-yloxy)butan-2-yl] N-(4-methylphenyl)sulfonylcarbamate;2,2,4,4,5-pentamethylhexyl N-(4-methylphenyl)sulfonylcarbamate |
|---|---|
| PubChem CID | 169235723 |
| Molecular Formula | C40H66N2O9S2 |
| Molecular Weight | 783.11 g/mol |
| Exact Mass | 782.42 |
| IUPAC Name | [2,3-dimethyl-4-(2-methylhexan-2-yloxy)butan-2-yl] N-(4-methylphenyl)sulfonylcarbamate;2,2,4,4,5-pentamethylhexyl N-(4-methylphenyl)sulfonylcarbamate |
| SMILES | CCCCC(C)(C)OCC(C)C(C)(C)OC(=O)NS(=O)(=O)c1ccc(C)cc1.Cc1ccc(S(=O)(=O)NC(=O)OCC(C)(C)CC(C)(C)C(C)C)cc1 |
| InChI | InChI=1S/C21H35NO5S.C19H31NO4S/c1-8-9-14-20(4,5)26-15-17(3)21(6,7)27-19(23)22-28(24,25)18-12-10-16(2)11-13-18;1-14(2)19(6,7)12-18(4,5)13-24-17(21)20-25(22,23)16-10-8-15(3)9-11-16/h10-13,17H,8-9,14-15H2,1-7H3,(H,22,23);8-11,14H,12-13H2,1-7H3,(H,20,21) |
| InChIKey | LXOUXLBHJKQWIW-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 154.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.11 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |