C14H22N2O4S — CID 138975303
2-hydroxyethyl N'-tert-butyl-N-(4-methylphenyl)sulfonylcarbamimidate (PubChem CID 138975303) has the molecular formula C14H22N2O4S and a molecular weight of 314.41 g/mol. Its IUPAC name is 2-hydroxyethyl N'-tert-butyl-N-(4-methylphenyl)sulfonylcarbamimidate.
| Compound Name | 2-hydroxyethyl N'-tert-butyl-N-(4-methylphenyl)sulfonylcarbamimidate |
|---|---|
| PubChem CID | 138975303 |
| Molecular Formula | C14H22N2O4S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 2-hydroxyethyl N'-tert-butyl-N-(4-methylphenyl)sulfonylcarbamimidate |
| SMILES | Cc1ccc(S(=O)(=O)N/C(=N/C(C)(C)C)OCCO)cc1 |
| InChI | InChI=1S/C14H22N2O4S/c1-11-5-7-12(8-6-11)21(18,19)16-13(20-10-9-17)15-14(2,3)4/h5-8,17H,9-10H2,1-4H3,(H,15,16) |
| InChIKey | KEEIXAGGMKMLME-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|