C22H24N2O8S2 — CID 11005717
[(1R,4S)-4-[(4-methylphenyl)sulfonylcarbamoyloxy]cyclohex-2-en-1-yl] N-(4-methylphenyl)sulfonylcarbamate (PubChem CID 11005717) has the molecular formula C22H24N2O8S2 and a molecular weight of 508.57 g/mol. Its IUPAC name is [(1R,4S)-4-[(4-methylphenyl)sulfonylcarbamoyloxy]cyclohex-2-en-1-yl] N-(4-methylphenyl)sulfonylcarbamate.
| Compound Name | [(1R,4S)-4-[(4-methylphenyl)sulfonylcarbamoyloxy]cyclohex-2-en-1-yl] N-(4-methylphenyl)sulfonylcarbamate |
|---|---|
| PubChem CID | 11005717 |
| Molecular Formula | C22H24N2O8S2 |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.10 |
| IUPAC Name | [(1R,4S)-4-[(4-methylphenyl)sulfonylcarbamoyloxy]cyclohex-2-en-1-yl] N-(4-methylphenyl)sulfonylcarbamate |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)O[C@@H]2C=C[C@H](OC(=O)NS(=O)(=O)c3ccc(C)cc3)CC2)cc1 |
| InChI | InChI=1S/C22H24N2O8S2/c1-15-3-11-19(12-4-15)33(27,28)23-21(25)31-17-7-9-18(10-8-17)32-22(26)24-34(29,30)20-13-5-16(2)6-14-20/h3-7,9,11-14,17-18H,8,10H2,1-2H3,(H,23,25)(H,24,26)/t17-,18+ |
| InChIKey | GMVXLZBETVTHMT-HDICACEKSA-N |
| XLogP | 2.92 |
| TPSA | 144.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|