About (2-methylpropan-2-yl)oxy N-(benzenesulfonyl)carbamoperoxoate
(2-methylpropan-2-yl)oxy N-(benzenesulfonyl)carbamoperoxoate (PubChem CID 139797591) has the molecular formula C11H15NO6S
and a molecular weight of 289.31 g/mol. Its IUPAC name is (2-methylpropan-2-yl)oxy N-(benzenesulfonyl)carbamoperoxoate.
Molecular Properties
| Compound Name | (2-methylpropan-2-yl)oxy N-(benzenesulfonyl)carbamoperoxoate |
| PubChem CID | 139797591 |
| Molecular Formula | C11H15NO6S |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | (2-methylpropan-2-yl)oxy N-(benzenesulfonyl)carbamoperoxoate |
| SMILES | CC(C)(C)OOOC(=O)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C11H15NO6S/c1-11(2,3)17-18-16-10(13)12-19(14,15)9-7-5-4-6-8-9/h4-8H,1-3H3,(H,12,13) |
| InChIKey | WHOBEDYWJYDNFN-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze (2-methylpropan-2-yl)oxy N-(benzenesulfonyl)carbamoperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylpropan-2-yl)oxy N-(benzenesulfonyl)carbamoperoxoate?
The IUPAC name of (2-methylpropan-2-yl)oxy N-(benzenesulfonyl)carbamoperoxoate (CID 139797591) is (2-methylpropan-2-yl)oxy N-(benzenesulfonyl)carbamoperoxoate.
What is the SMILES notation for (2-methylpropan-2-yl)oxy N-(benzenesulfonyl)carbamoperoxoate?
The canonical SMILES for (2-methylpropan-2-yl)oxy N-(benzenesulfonyl)carbamoperoxoate is CC(C)(C)OOOC(=O)NS(=O)(=O)c1ccccc1.
What is the InChIKey of (2-methylpropan-2-yl)oxy N-(benzenesulfonyl)carbamoperoxoate?
The InChIKey is WHOBEDYWJYDNFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO6S/c1-11(2,3)17-18-16-10(13)12-19(14,15)9-7-5-4-6-8-9/h4-8H,1-3H3,(H,12,13).
What are the key properties of (2-methylpropan-2-yl)oxy N-(benzenesulfonyl)carbamoperoxoate?
(2-methylpropan-2-yl)oxy N-(benzenesulfonyl)carbamoperoxoate has a molecular weight of 289.31 g/mol, XLogP of 1.76, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylpropan-2-yl)oxy N-(benzenesulfonyl)carbamoperoxoate is sourced from PubChem (CID 139797591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).