C12H15NO4S — CID 91092490
N-(benzenesulfonyl)-2,2-dimethyl-4-oxobutanamide (PubChem CID 91092490) has the molecular formula C12H15NO4S and a molecular weight of 269.32 g/mol. Its IUPAC name is N-(benzenesulfonyl)-2,2-dimethyl-4-oxobutanamide.
| Compound Name | N-(benzenesulfonyl)-2,2-dimethyl-4-oxobutanamide |
|---|---|
| PubChem CID | 91092490 |
| Molecular Formula | C12H15NO4S |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | N-(benzenesulfonyl)-2,2-dimethyl-4-oxobutanamide |
| SMILES | CC(C)(CC=O)C(=O)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H15NO4S/c1-12(2,8-9-14)11(15)13-18(16,17)10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3,(H,13,15) |
| InChIKey | OWWROLAEOHVRRH-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|