C30H24N2O3S — CID 57394717
[7-cyano-2,3-bis(4-methylphenyl)indolizin-1-yl] 4-methylbenzenesulfonate (PubChem CID 57394717) has the molecular formula C30H24N2O3S and a molecular weight of 492.60 g/mol. Its IUPAC name is [7-cyano-2,3-bis(4-methylphenyl)indolizin-1-yl] 4-methylbenzenesulfonate.
| Compound Name | [7-cyano-2,3-bis(4-methylphenyl)indolizin-1-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 57394717 |
| Molecular Formula | C30H24N2O3S |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | [7-cyano-2,3-bis(4-methylphenyl)indolizin-1-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(-c2c(OS(=O)(=O)c3ccc(C)cc3)c3cc(C#N)ccn3c2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C30H24N2O3S/c1-20-4-10-24(11-5-20)28-29(25-12-6-21(2)7-13-25)32-17-16-23(19-31)18-27(32)30(28)35-36(33,34)26-14-8-22(3)9-15-26/h4-18H,1-3H3 |
| InChIKey | TWTZXICLLPTNFS-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 71.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|