C24H28N2O3S — CID 57403345
(2,3-dibutyl-7-cyanoindolizin-1-yl) 4-methylbenzenesulfonate (PubChem CID 57403345) has the molecular formula C24H28N2O3S and a molecular weight of 424.57 g/mol. Its IUPAC name is (2,3-dibutyl-7-cyanoindolizin-1-yl) 4-methylbenzenesulfonate.
| Compound Name | (2,3-dibutyl-7-cyanoindolizin-1-yl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 57403345 |
| Molecular Formula | C24H28N2O3S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | (2,3-dibutyl-7-cyanoindolizin-1-yl) 4-methylbenzenesulfonate |
| SMILES | CCCCc1c(OS(=O)(=O)c2ccc(C)cc2)c2cc(C#N)ccn2c1CCCC |
| InChI | InChI=1S/C24H28N2O3S/c1-4-6-8-21-22(9-7-5-2)26-15-14-19(17-25)16-23(26)24(21)29-30(27,28)20-12-10-18(3)11-13-20/h10-16H,4-9H2,1-3H3 |
| InChIKey | OLMMGHPBUBMCEB-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 71.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|