C16H10FN3 — CID 72700847
5-(4-fluorophenyl)triazolo[5,1-a]isoquinoline (PubChem CID 72700847) has the molecular formula C16H10FN3 and a molecular weight of 263.28 g/mol. Its IUPAC name is 5-(4-fluorophenyl)triazolo[5,1-a]isoquinoline.
| Compound Name | 5-(4-fluorophenyl)triazolo[5,1-a]isoquinoline |
|---|---|
| PubChem CID | 72700847 |
| Molecular Formula | C16H10FN3 |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 5-(4-fluorophenyl)triazolo[5,1-a]isoquinoline |
| SMILES | Fc1ccc(-c2cc3ccccc3c3cnnn23)cc1 |
| InChI | InChI=1S/C16H10FN3/c17-13-7-5-11(6-8-13)15-9-12-3-1-2-4-14(12)16-10-18-19-20(15)16/h1-10H |
| InChIKey | SQXHORIPUZSJBE-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |