C24H10F8GeI2 — CID 635664
diphenyl-bis(2,3,4,5-tetrafluoro-6-iodophenyl)germane (PubChem CID 635664) has the molecular formula C24H10F8GeI2 and a molecular weight of 776.75 g/mol. Its IUPAC name is diphenyl-bis(2,3,4,5-tetrafluoro-6-iodophenyl)germane.
| Compound Name | diphenyl-bis(2,3,4,5-tetrafluoro-6-iodophenyl)germane |
|---|---|
| PubChem CID | 635664 |
| Molecular Formula | C24H10F8GeI2 |
| Molecular Weight | 776.75 g/mol |
| Exact Mass | 777.80 |
| IUPAC Name | diphenyl-bis(2,3,4,5-tetrafluoro-6-iodophenyl)germane |
| SMILES | Fc1c(F)c(F)c([Ge](c2ccccc2)(c2ccccc2)c2c(F)c(F)c(F)c(F)c2I)c(I)c1F |
| InChI | InChI=1S/C24H10F8GeI2/c25-13-15(27)19(31)23(34)21(17(13)29)33(11-7-3-1-4-8-11,12-9-5-2-6-10-12)22-18(30)14(26)16(28)20(32)24(22)35/h1-10H |
| InChIKey | XGULJHHSXYQBNJ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.75 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|