C12H5BrF3I — CID 141175121
1-bromo-2,3,6-trifluoro-5-iodo-4-phenylbenzene (PubChem CID 141175121) has the molecular formula C12H5BrF3I and a molecular weight of 412.97 g/mol. Its IUPAC name is 1-bromo-2,3,6-trifluoro-5-iodo-4-phenylbenzene.
| Compound Name | 1-bromo-2,3,6-trifluoro-5-iodo-4-phenylbenzene |
|---|---|
| PubChem CID | 141175121 |
| Molecular Formula | C12H5BrF3I |
| Molecular Weight | 412.97 g/mol |
| Exact Mass | 411.86 |
| IUPAC Name | 1-bromo-2,3,6-trifluoro-5-iodo-4-phenylbenzene |
| SMILES | Fc1c(F)c(-c2ccccc2)c(I)c(F)c1Br |
| InChI | InChI=1S/C12H5BrF3I/c13-8-10(15)9(14)7(12(17)11(8)16)6-4-2-1-3-5-6/h1-5H |
| InChIKey | BLFAWCCNAPDIDB-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.97 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|