About 4-triphenylgermylphenol
4-triphenylgermylphenol (PubChem CID 101491471) has the molecular formula C24H20GeO
and a molecular weight of 397.03 g/mol. Its IUPAC name is 4-triphenylgermylphenol.
Molecular Properties
| Compound Name | 4-triphenylgermylphenol |
| PubChem CID | 101491471 |
| Molecular Formula | C24H20GeO |
| Molecular Weight | 397.03 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | 4-triphenylgermylphenol |
| SMILES | Oc1ccc([Ge](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20GeO/c26-24-18-16-23(17-19-24)25(20-10-4-1-5-11-20,21-12-6-2-7-13-21)22-14-8-3-9-15-22/h1-19,26H |
| InChIKey | QFDXAFGZBMGESH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.03 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-triphenylgermylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-triphenylgermylphenol?
The IUPAC name of 4-triphenylgermylphenol (CID 101491471) is 4-triphenylgermylphenol.
What is the SMILES notation for 4-triphenylgermylphenol?
The canonical SMILES for 4-triphenylgermylphenol is Oc1ccc([Ge](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 4-triphenylgermylphenol?
The InChIKey is QFDXAFGZBMGESH-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20GeO/c26-24-18-16-23(17-19-24)25(20-10-4-1-5-11-20,21-12-6-2-7-13-21)22-14-8-3-9-15-22/h1-19,26H.
What are the key properties of 4-triphenylgermylphenol?
4-triphenylgermylphenol has a molecular weight of 397.03 g/mol, XLogP of 2.77, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-triphenylgermylphenol is sourced from PubChem (CID 101491471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).