C19H18F3NO5S — CID 55822352
3-(benzenesulfonyl)propyl 2-[[4-(trifluoromethyl)benzoyl]amino]acetate (PubChem CID 55822352) has the molecular formula C19H18F3NO5S and a molecular weight of 429.42 g/mol. Its IUPAC name is 3-(benzenesulfonyl)propyl 2-[[4-(trifluoromethyl)benzoyl]amino]acetate.
| Compound Name | 3-(benzenesulfonyl)propyl 2-[[4-(trifluoromethyl)benzoyl]amino]acetate |
|---|---|
| PubChem CID | 55822352 |
| Molecular Formula | C19H18F3NO5S |
| Molecular Weight | 429.42 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | 3-(benzenesulfonyl)propyl 2-[[4-(trifluoromethyl)benzoyl]amino]acetate |
| SMILES | O=C(CNC(=O)c1ccc(C(F)(F)F)cc1)OCCCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H18F3NO5S/c20-19(21,22)15-9-7-14(8-10-15)18(25)23-13-17(24)28-11-4-12-29(26,27)16-5-2-1-3-6-16/h1-3,5-10H,4,11-13H2,(H,23,25) |
| InChIKey | FGTZWSDDJPBWKW-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.42 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|