C21H21N3O2S — CID 22433456
3-(3-acetylphenyl)-1-(4-phenyl-1,3-thiazol-2-yl)-1-propylurea (PubChem CID 22433456) has the molecular formula C21H21N3O2S and a molecular weight of 379.49 g/mol. Its IUPAC name is 3-(3-acetylphenyl)-1-(4-phenyl-1,3-thiazol-2-yl)-1-propylurea.
| Compound Name | 3-(3-acetylphenyl)-1-(4-phenyl-1,3-thiazol-2-yl)-1-propylurea |
|---|---|
| PubChem CID | 22433456 |
| Molecular Formula | C21H21N3O2S |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 3-(3-acetylphenyl)-1-(4-phenyl-1,3-thiazol-2-yl)-1-propylurea |
| SMILES | CCCN(C(=O)Nc1cccc(C(C)=O)c1)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C21H21N3O2S/c1-3-12-24(20(26)22-18-11-7-10-17(13-18)15(2)25)21-23-19(14-27-21)16-8-5-4-6-9-16/h4-11,13-14H,3,12H2,1-2H3,(H,22,26) |
| InChIKey | FIUQCECYAMSKDF-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |