C21H23N3O3S — CID 22433461
3-(2,5-dimethoxyphenyl)-1-(4-phenyl-1,3-thiazol-2-yl)-1-propylurea (PubChem CID 22433461) has the molecular formula C21H23N3O3S and a molecular weight of 397.50 g/mol. Its IUPAC name is 3-(2,5-dimethoxyphenyl)-1-(4-phenyl-1,3-thiazol-2-yl)-1-propylurea.
| Compound Name | 3-(2,5-dimethoxyphenyl)-1-(4-phenyl-1,3-thiazol-2-yl)-1-propylurea |
|---|---|
| PubChem CID | 22433461 |
| Molecular Formula | C21H23N3O3S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 3-(2,5-dimethoxyphenyl)-1-(4-phenyl-1,3-thiazol-2-yl)-1-propylurea |
| SMILES | CCCN(C(=O)Nc1cc(OC)ccc1OC)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C21H23N3O3S/c1-4-12-24(21-23-18(14-28-21)15-8-6-5-7-9-15)20(25)22-17-13-16(26-2)10-11-19(17)27-3/h5-11,13-14H,4,12H2,1-3H3,(H,22,25) |
| InChIKey | XRBXJTUBUQIGSR-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |