C26H31N3O2S — CID 22433513
1-[4-(4-cyclohexylphenyl)-1,3-thiazol-2-yl]-3-(2-methoxyphenyl)-1-propylurea (PubChem CID 22433513) has the molecular formula C26H31N3O2S and a molecular weight of 449.62 g/mol. Its IUPAC name is 1-[4-(4-cyclohexylphenyl)-1,3-thiazol-2-yl]-3-(2-methoxyphenyl)-1-propylurea.
| Compound Name | 1-[4-(4-cyclohexylphenyl)-1,3-thiazol-2-yl]-3-(2-methoxyphenyl)-1-propylurea |
|---|---|
| PubChem CID | 22433513 |
| Molecular Formula | C26H31N3O2S |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | 1-[4-(4-cyclohexylphenyl)-1,3-thiazol-2-yl]-3-(2-methoxyphenyl)-1-propylurea |
| SMILES | CCCN(C(=O)Nc1ccccc1OC)c1nc(-c2ccc(C3CCCCC3)cc2)cs1 |
| InChI | InChI=1S/C26H31N3O2S/c1-3-17-29(25(30)27-22-11-7-8-12-24(22)31-2)26-28-23(18-32-26)21-15-13-20(14-16-21)19-9-5-4-6-10-19/h7-8,11-16,18-19H,3-6,9-10,17H2,1-2H3,(H,27,30) |
| InChIKey | DGQCQLDNZYOJDA-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |