C24H26N4O3S — CID 28703333
1-[4-(4-cyclohexylphenyl)-1,3-thiazol-2-yl]-1-ethyl-3-(2-nitrophenyl)urea (PubChem CID 28703333) has the molecular formula C24H26N4O3S and a molecular weight of 450.56 g/mol. Its IUPAC name is 1-[4-(4-cyclohexylphenyl)-1,3-thiazol-2-yl]-1-ethyl-3-(2-nitrophenyl)urea.
| Compound Name | 1-[4-(4-cyclohexylphenyl)-1,3-thiazol-2-yl]-1-ethyl-3-(2-nitrophenyl)urea |
|---|---|
| PubChem CID | 28703333 |
| Molecular Formula | C24H26N4O3S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | 1-[4-(4-cyclohexylphenyl)-1,3-thiazol-2-yl]-1-ethyl-3-(2-nitrophenyl)urea |
| SMILES | CCN(C(=O)Nc1ccccc1[N+](=O)[O-])c1nc(-c2ccc(C3CCCCC3)cc2)cs1 |
| InChI | InChI=1S/C24H26N4O3S/c1-2-27(23(29)25-20-10-6-7-11-22(20)28(30)31)24-26-21(16-32-24)19-14-12-18(13-15-19)17-8-4-3-5-9-17/h6-7,10-17H,2-5,8-9H2,1H3,(H,25,29) |
| InChIKey | XPKTXLHRKADKKA-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|