C18H15BrN4O3S — CID 28703312
1-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-1-ethyl-3-(2-nitrophenyl)urea (PubChem CID 28703312) has the molecular formula C18H15BrN4O3S and a molecular weight of 447.31 g/mol. Its IUPAC name is 1-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-1-ethyl-3-(2-nitrophenyl)urea.
| Compound Name | 1-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-1-ethyl-3-(2-nitrophenyl)urea |
|---|---|
| PubChem CID | 28703312 |
| Molecular Formula | C18H15BrN4O3S |
| Molecular Weight | 447.31 g/mol |
| Exact Mass | 446.00 |
| IUPAC Name | 1-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-1-ethyl-3-(2-nitrophenyl)urea |
| SMILES | CCN(C(=O)Nc1ccccc1[N+](=O)[O-])c1nc(-c2ccc(Br)cc2)cs1 |
| InChI | InChI=1S/C18H15BrN4O3S/c1-2-22(17(24)20-14-5-3-4-6-16(14)23(25)26)18-21-15(11-27-18)12-7-9-13(19)10-8-12/h3-11H,2H2,1H3,(H,20,24) |
| InChIKey | UDJBVFOGLUGUJY-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.31 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|