C25H28N4O4S — CID 30596784
1-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-(2-methoxyphenyl)-1-(3,4,5,6-tetrahydro-2H-azepin-7-yl)urea (PubChem CID 30596784) has the molecular formula C25H28N4O4S and a molecular weight of 480.59 g/mol. Its IUPAC name is 1-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-(2-methoxyphenyl)-1-(3,4,5,6-tetrahydro-2H-azepin-7-yl)urea.
| Compound Name | 1-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-(2-methoxyphenyl)-1-(3,4,5,6-tetrahydro-2H-azepin-7-yl)urea |
|---|---|
| PubChem CID | 30596784 |
| Molecular Formula | C25H28N4O4S |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | 1-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-(2-methoxyphenyl)-1-(3,4,5,6-tetrahydro-2H-azepin-7-yl)urea |
| SMILES | COc1ccccc1NC(=O)N(C1=NCCCCC1)c1nc(-c2ccc(OC)c(OC)c2)cs1 |
| InChI | InChI=1S/C25H28N4O4S/c1-31-20-10-7-6-9-18(20)27-24(30)29(23-11-5-4-8-14-26-23)25-28-19(16-34-25)17-12-13-21(32-2)22(15-17)33-3/h6-7,9-10,12-13,15-16H,4-5,8,11,14H2,1-3H3,(H,27,30) |
| InChIKey | ZCCYEMNMEVVTNN-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 85.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |