C15H16N2O4S — CID 139664300
[5-[2-[acetyl(methyl)amino]-1,3-thiazol-4-yl]-2-methoxyphenyl] acetate (PubChem CID 139664300) has the molecular formula C15H16N2O4S and a molecular weight of 320.37 g/mol. Its IUPAC name is [5-[2-[acetyl(methyl)amino]-1,3-thiazol-4-yl]-2-methoxyphenyl] acetate.
| Compound Name | [5-[2-[acetyl(methyl)amino]-1,3-thiazol-4-yl]-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 139664300 |
| Molecular Formula | C15H16N2O4S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | [5-[2-[acetyl(methyl)amino]-1,3-thiazol-4-yl]-2-methoxyphenyl] acetate |
| SMILES | COc1ccc(-c2csc(N(C)C(C)=O)n2)cc1OC(C)=O |
| InChI | InChI=1S/C15H16N2O4S/c1-9(18)17(3)15-16-12(8-22-15)11-5-6-13(20-4)14(7-11)21-10(2)19/h5-8H,1-4H3 |
| InChIKey | RDSGDUAYMWPJMC-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|