C23H26N2OS — CID 22433301
4-tert-butyl-N-(4-phenyl-1,3-thiazol-2-yl)-N-propylbenzamide (PubChem CID 22433301) has the molecular formula C23H26N2OS and a molecular weight of 378.54 g/mol. Its IUPAC name is 4-tert-butyl-N-(4-phenyl-1,3-thiazol-2-yl)-N-propylbenzamide.
| Compound Name | 4-tert-butyl-N-(4-phenyl-1,3-thiazol-2-yl)-N-propylbenzamide |
|---|---|
| PubChem CID | 22433301 |
| Molecular Formula | C23H26N2OS |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 4-tert-butyl-N-(4-phenyl-1,3-thiazol-2-yl)-N-propylbenzamide |
| SMILES | CCCN(C(=O)c1ccc(C(C)(C)C)cc1)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C23H26N2OS/c1-5-15-25(21(26)18-11-13-19(14-12-18)23(2,3)4)22-24-20(16-27-22)17-9-7-6-8-10-17/h6-14,16H,5,15H2,1-4H3 |
| InChIKey | WTYBLRYFSDQPRS-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |