C28H28N2OS — CID 3173513
4-tert-butyl-N-(2-phenylethyl)-N-(4-phenyl-1,3-thiazol-2-yl)benzamide (PubChem CID 3173513) has the molecular formula C28H28N2OS and a molecular weight of 440.61 g/mol. Its IUPAC name is 4-tert-butyl-N-(2-phenylethyl)-N-(4-phenyl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 4-tert-butyl-N-(2-phenylethyl)-N-(4-phenyl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 3173513 |
| Molecular Formula | C28H28N2OS |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | 4-tert-butyl-N-(2-phenylethyl)-N-(4-phenyl-1,3-thiazol-2-yl)benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)N(CCc2ccccc2)c2nc(-c3ccccc3)cs2)cc1 |
| InChI | InChI=1S/C28H28N2OS/c1-28(2,3)24-16-14-23(15-17-24)26(31)30(19-18-21-10-6-4-7-11-21)27-29-25(20-32-27)22-12-8-5-9-13-22/h4-17,20H,18-19H2,1-3H3 |
| InChIKey | WHYFOPIOXGYXHP-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |