C18H15FN2OS — CID 1175847
N-ethyl-3-fluoro-N-(4-phenyl-1,3-thiazol-2-yl)benzamide (PubChem CID 1175847) has the molecular formula C18H15FN2OS and a molecular weight of 326.40 g/mol. Its IUPAC name is N-ethyl-3-fluoro-N-(4-phenyl-1,3-thiazol-2-yl)benzamide.
| Compound Name | N-ethyl-3-fluoro-N-(4-phenyl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 1175847 |
| Molecular Formula | C18H15FN2OS |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | N-ethyl-3-fluoro-N-(4-phenyl-1,3-thiazol-2-yl)benzamide |
| SMILES | CCN(C(=O)c1cccc(F)c1)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C18H15FN2OS/c1-2-21(17(22)14-9-6-10-15(19)11-14)18-20-16(12-23-18)13-7-4-3-5-8-13/h3-12H,2H2,1H3 |
| InChIKey | IQTQYHZBHLMGPK-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |