C19H19N3O2S3 — CID 17271421
O-ethyl [2-[[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]-prop-2-enylamino]-2-oxoethyl]sulfanylmethanethioate (PubChem CID 17271421) has the molecular formula C19H19N3O2S3 and a molecular weight of 417.58 g/mol. Its IUPAC name is O-ethyl [2-[[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]-prop-2-enylamino]-2-oxoethyl]sulfanylmethanethioate.
| Compound Name | O-ethyl [2-[[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]-prop-2-enylamino]-2-oxoethyl]sulfanylmethanethioate |
|---|---|
| PubChem CID | 17271421 |
| Molecular Formula | C19H19N3O2S3 |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | O-ethyl [2-[[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]-prop-2-enylamino]-2-oxoethyl]sulfanylmethanethioate |
| SMILES | C=CCN(C(=O)CSC(=S)OCC)c1nc(-c2c[nH]c3ccccc23)cs1 |
| InChI | InChI=1S/C19H19N3O2S3/c1-3-9-22(17(23)12-27-19(25)24-4-2)18-21-16(11-26-18)14-10-20-15-8-6-5-7-13(14)15/h3,5-8,10-11,20H,1,4,9,12H2,2H3 |
| InChIKey | YYFCNPZSWOGCCL-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|