C18H19N3O2S2 — CID 17271418
2-(2-hydroxyethylsulfanyl)-N-[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]-N-prop-2-enylacetamide (PubChem CID 17271418) has the molecular formula C18H19N3O2S2 and a molecular weight of 373.50 g/mol. Its IUPAC name is 2-(2-hydroxyethylsulfanyl)-N-[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]-N-prop-2-enylacetamide.
| Compound Name | 2-(2-hydroxyethylsulfanyl)-N-[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 17271418 |
| Molecular Formula | C18H19N3O2S2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | 2-(2-hydroxyethylsulfanyl)-N-[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]-N-prop-2-enylacetamide |
| SMILES | C=CCN(C(=O)CSCCO)c1nc(-c2c[nH]c3ccccc23)cs1 |
| InChI | InChI=1S/C18H19N3O2S2/c1-2-7-21(17(23)12-24-9-8-22)18-20-16(11-25-18)14-10-19-15-6-4-3-5-13(14)15/h2-6,10-11,19,22H,1,7-9,12H2 |
| InChIKey | NMUQECXMCCRAEE-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|