C18H17N3O3S2 — CID 17271420
2-[2-[[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]-prop-2-enylamino]-2-oxoethyl]sulfanylacetic acid (PubChem CID 17271420) has the molecular formula C18H17N3O3S2 and a molecular weight of 387.49 g/mol. Its IUPAC name is 2-[2-[[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]-prop-2-enylamino]-2-oxoethyl]sulfanylacetic acid.
| Compound Name | 2-[2-[[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]-prop-2-enylamino]-2-oxoethyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 17271420 |
| Molecular Formula | C18H17N3O3S2 |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | 2-[2-[[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]-prop-2-enylamino]-2-oxoethyl]sulfanylacetic acid |
| SMILES | C=CCN(C(=O)CSCC(=O)O)c1nc(-c2c[nH]c3ccccc23)cs1 |
| InChI | InChI=1S/C18H17N3O3S2/c1-2-7-21(16(22)10-25-11-17(23)24)18-20-15(9-26-18)13-8-19-14-6-4-3-5-12(13)14/h2-6,8-9,19H,1,7,10-11H2,(H,23,24) |
| InChIKey | LGHBLKXCDFIWAS-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|