C26H25N3O3S2 — CID 17425049
2-(2,4-dimethylquinolin-3-yl)-N-[4-(4-methylsulfonylphenyl)-1,3-thiazol-2-yl]-N-prop-2-enylacetamide (PubChem CID 17425049) has the molecular formula C26H25N3O3S2 and a molecular weight of 491.64 g/mol. Its IUPAC name is 2-(2,4-dimethylquinolin-3-yl)-N-[4-(4-methylsulfonylphenyl)-1,3-thiazol-2-yl]-N-prop-2-enylacetamide.
| Compound Name | 2-(2,4-dimethylquinolin-3-yl)-N-[4-(4-methylsulfonylphenyl)-1,3-thiazol-2-yl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 17425049 |
| Molecular Formula | C26H25N3O3S2 |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | 2-(2,4-dimethylquinolin-3-yl)-N-[4-(4-methylsulfonylphenyl)-1,3-thiazol-2-yl]-N-prop-2-enylacetamide |
| SMILES | C=CCN(C(=O)Cc1c(C)nc2ccccc2c1C)c1nc(-c2ccc(S(C)(=O)=O)cc2)cs1 |
| InChI | InChI=1S/C26H25N3O3S2/c1-5-14-29(25(30)15-22-17(2)21-8-6-7-9-23(21)27-18(22)3)26-28-24(16-33-26)19-10-12-20(13-11-19)34(4,31)32/h5-13,16H,1,14-15H2,2-4H3 |
| InChIKey | WZQNUCDZLWGFII-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 80.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|