C18H20N2O4S — CID 47074172
ethyl 2-[2-phenoxypropanoyl(prop-2-enyl)amino]-1,3-thiazole-4-carboxylate (PubChem CID 47074172) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is ethyl 2-[2-phenoxypropanoyl(prop-2-enyl)amino]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[2-phenoxypropanoyl(prop-2-enyl)amino]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 47074172 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | ethyl 2-[2-phenoxypropanoyl(prop-2-enyl)amino]-1,3-thiazole-4-carboxylate |
| SMILES | C=CCN(C(=O)C(C)Oc1ccccc1)c1nc(C(=O)OCC)cs1 |
| InChI | InChI=1S/C18H20N2O4S/c1-4-11-20(18-19-15(12-25-18)17(22)23-5-2)16(21)13(3)24-14-9-7-6-8-10-14/h4,6-10,12-13H,1,5,11H2,2-3H3 |
| InChIKey | JJDHLKWIZBRRKM-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|