C15H14ClN3O4S — CID 4874446
ethyl 2-[benzamido-(2-chloroacetyl)amino]-1,3-thiazole-4-carboxylate (PubChem CID 4874446) has the molecular formula C15H14ClN3O4S and a molecular weight of 367.81 g/mol. Its IUPAC name is ethyl 2-[benzamido-(2-chloroacetyl)amino]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[benzamido-(2-chloroacetyl)amino]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 4874446 |
| Molecular Formula | C15H14ClN3O4S |
| Molecular Weight | 367.81 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | ethyl 2-[benzamido-(2-chloroacetyl)amino]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(N(NC(=O)c2ccccc2)C(=O)CCl)n1 |
| InChI | InChI=1S/C15H14ClN3O4S/c1-2-23-14(22)11-9-24-15(17-11)19(12(20)8-16)18-13(21)10-6-4-3-5-7-10/h3-7,9H,2,8H2,1H3,(H,18,21) |
| InChIKey | BKYVODLTIQVMTA-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.81 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|