C16H19IN2O2S — CID 168985808
ethyl 2-(5-iodo-2-methyl-N-propylanilino)-1,3-thiazole-4-carboxylate (PubChem CID 168985808) has the molecular formula C16H19IN2O2S and a molecular weight of 430.31 g/mol. Its IUPAC name is ethyl 2-(5-iodo-2-methyl-N-propylanilino)-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-(5-iodo-2-methyl-N-propylanilino)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 168985808 |
| Molecular Formula | C16H19IN2O2S |
| Molecular Weight | 430.31 g/mol |
| Exact Mass | 430.02 |
| IUPAC Name | ethyl 2-(5-iodo-2-methyl-N-propylanilino)-1,3-thiazole-4-carboxylate |
| SMILES | CCCN(c1nc(C(=O)OCC)cs1)c1cc(I)ccc1C |
| InChI | InChI=1S/C16H19IN2O2S/c1-4-8-19(14-9-12(17)7-6-11(14)3)16-18-13(10-22-16)15(20)21-5-2/h6-7,9-10H,4-5,8H2,1-3H3 |
| InChIKey | QQOMQZRQKFCEGJ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.31 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|