C14H13N3O2S — CID 80569603
ethyl 2-(2-cyano-N-methylanilino)-1,3-thiazole-4-carboxylate (PubChem CID 80569603) has the molecular formula C14H13N3O2S and a molecular weight of 287.34 g/mol. Its IUPAC name is ethyl 2-(2-cyano-N-methylanilino)-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-(2-cyano-N-methylanilino)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 80569603 |
| Molecular Formula | C14H13N3O2S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | ethyl 2-(2-cyano-N-methylanilino)-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(N(C)c2ccccc2C#N)n1 |
| InChI | InChI=1S/C14H13N3O2S/c1-3-19-13(18)11-9-20-14(16-11)17(2)12-7-5-4-6-10(12)8-15/h4-7,9H,3H2,1-2H3 |
| InChIKey | ZEQDNFOERJPXAB-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 66.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |