C19H18IN3O2S — CID 174489557
ethyl 2-[5-(3-iodoanilino)-2-methylanilino]-1,3-thiazole-4-carboxylate (PubChem CID 174489557) has the molecular formula C19H18IN3O2S and a molecular weight of 479.34 g/mol. Its IUPAC name is ethyl 2-[5-(3-iodoanilino)-2-methylanilino]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[5-(3-iodoanilino)-2-methylanilino]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 174489557 |
| Molecular Formula | C19H18IN3O2S |
| Molecular Weight | 479.34 g/mol |
| Exact Mass | 479.02 |
| IUPAC Name | ethyl 2-[5-(3-iodoanilino)-2-methylanilino]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(Nc2cc(Nc3cccc(I)c3)ccc2C)n1 |
| InChI | InChI=1S/C19H18IN3O2S/c1-3-25-18(24)17-11-26-19(23-17)22-16-10-15(8-7-12(16)2)21-14-6-4-5-13(20)9-14/h4-11,21H,3H2,1-2H3,(H,22,23) |
| InChIKey | VCBXOQQZWQKVLK-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.34 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|