C15H19ClN4O4S — CID 155592818
ethyl 2-[(6-chloro-5-methylpyridazin-3-yl)-(2,2-dimethoxyethyl)amino]-1,3-thiazole-4-carboxylate (PubChem CID 155592818) has the molecular formula C15H19ClN4O4S and a molecular weight of 386.86 g/mol. Its IUPAC name is ethyl 2-[(6-chloro-5-methylpyridazin-3-yl)-(2,2-dimethoxyethyl)amino]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[(6-chloro-5-methylpyridazin-3-yl)-(2,2-dimethoxyethyl)amino]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 155592818 |
| Molecular Formula | C15H19ClN4O4S |
| Molecular Weight | 386.86 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | ethyl 2-[(6-chloro-5-methylpyridazin-3-yl)-(2,2-dimethoxyethyl)amino]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(N(CC(OC)OC)c2cc(C)c(Cl)nn2)n1 |
| InChI | InChI=1S/C15H19ClN4O4S/c1-5-24-14(21)10-8-25-15(17-10)20(7-12(22-3)23-4)11-6-9(2)13(16)19-18-11/h6,8,12H,5,7H2,1-4H3 |
| InChIKey | MGSUWXBHRHKLJD-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 86.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.86 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|