C20H17ClN4O4S — CID 1497931
ethyl 2-[[(4-chlorobenzoyl)amino]-(phenylcarbamoyl)amino]-1,3-thiazole-4-carboxylate (PubChem CID 1497931) has the molecular formula C20H17ClN4O4S and a molecular weight of 444.90 g/mol. Its IUPAC name is ethyl 2-[[(4-chlorobenzoyl)amino]-(phenylcarbamoyl)amino]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[[(4-chlorobenzoyl)amino]-(phenylcarbamoyl)amino]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 1497931 |
| Molecular Formula | C20H17ClN4O4S |
| Molecular Weight | 444.90 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | ethyl 2-[[(4-chlorobenzoyl)amino]-(phenylcarbamoyl)amino]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(N(NC(=O)c2ccc(Cl)cc2)C(=O)Nc2ccccc2)n1 |
| InChI | InChI=1S/C20H17ClN4O4S/c1-2-29-18(27)16-12-30-20(23-16)25(19(28)22-15-6-4-3-5-7-15)24-17(26)13-8-10-14(21)11-9-13/h3-12H,2H2,1H3,(H,22,28)(H,24,26) |
| InChIKey | MNPAJCBHAZPCTJ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.90 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|