C12H13N3OS — CID 110748214
1-methyl-1-(4-methyl-1,3-thiazol-2-yl)-3-phenylurea (PubChem CID 110748214) has the molecular formula C12H13N3OS and a molecular weight of 247.32 g/mol. Its IUPAC name is 1-methyl-1-(4-methyl-1,3-thiazol-2-yl)-3-phenylurea.
| Compound Name | 1-methyl-1-(4-methyl-1,3-thiazol-2-yl)-3-phenylurea |
|---|---|
| PubChem CID | 110748214 |
| Molecular Formula | C12H13N3OS |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 1-methyl-1-(4-methyl-1,3-thiazol-2-yl)-3-phenylurea |
| SMILES | Cc1csc(N(C)C(=O)Nc2ccccc2)n1 |
| InChI | InChI=1S/C12H13N3OS/c1-9-8-17-12(13-9)15(2)11(16)14-10-6-4-3-5-7-10/h3-8H,1-2H3,(H,14,16) |
| InChIKey | CYRBXBFBGXSZFW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |