C21H21ClN4O3S — CID 41169254
N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-[(4R)-4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-prop-2-enylacetamide (PubChem CID 41169254) has the molecular formula C21H21ClN4O3S and a molecular weight of 444.94 g/mol. Its IUPAC name is N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-[(4R)-4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-prop-2-enylacetamide.
| Compound Name | N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-[(4R)-4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 41169254 |
| Molecular Formula | C21H21ClN4O3S |
| Molecular Weight | 444.94 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-[(4R)-4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-prop-2-enylacetamide |
| SMILES | C=CCN(C(=O)CN1C(=O)N[C@](C)(C2CC2)C1=O)c1nc(-c2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C21H21ClN4O3S/c1-3-10-25(20-23-16(12-30-20)13-4-8-15(22)9-5-13)17(27)11-26-18(28)21(2,14-6-7-14)24-19(26)29/h3-5,8-9,12,14H,1,6-7,10-11H2,2H3,(H,24,29)/t21-/m1/s1 |
| InChIKey | CUYLWYHCTBAJLE-OAQYLSRUSA-N |
| XLogP | 3.70 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.94 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|