C29H26N4O2 — CID 59110621
N-(4-carbamimidoylphenyl)-2-phenyl-N'-[(2-phenylphenyl)methyl]propanediamide (PubChem CID 59110621) has the molecular formula C29H26N4O2 and a molecular weight of 462.55 g/mol. Its IUPAC name is N-(4-carbamimidoylphenyl)-2-phenyl-N'-[(2-phenylphenyl)methyl]propanediamide.
| Compound Name | N-(4-carbamimidoylphenyl)-2-phenyl-N'-[(2-phenylphenyl)methyl]propanediamide |
|---|---|
| PubChem CID | 59110621 |
| Molecular Formula | C29H26N4O2 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | N-(4-carbamimidoylphenyl)-2-phenyl-N'-[(2-phenylphenyl)methyl]propanediamide |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)C(C(=O)NCc2ccccc2-c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H26N4O2/c30-27(31)22-15-17-24(18-16-22)33-29(35)26(21-11-5-2-6-12-21)28(34)32-19-23-13-7-8-14-25(23)20-9-3-1-4-10-20/h1-18,26H,19H2,(H3,30,31)(H,32,34)(H,33,35) |
| InChIKey | VWLODPUIQGRTFW-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 108.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|