C24H23N5O6 — CID 162119331
N-(4-carbamimidoylphenyl)-N'-[(3-nitrophenyl)methyl]-2-phenylpropanediamide;formic acid (PubChem CID 162119331) has the molecular formula C24H23N5O6 and a molecular weight of 477.48 g/mol. Its IUPAC name is N-(4-carbamimidoylphenyl)-N'-[(3-nitrophenyl)methyl]-2-phenylpropanediamide;formic acid.
| Compound Name | N-(4-carbamimidoylphenyl)-N'-[(3-nitrophenyl)methyl]-2-phenylpropanediamide;formic acid |
|---|---|
| PubChem CID | 162119331 |
| Molecular Formula | C24H23N5O6 |
| Molecular Weight | 477.48 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | N-(4-carbamimidoylphenyl)-N'-[(3-nitrophenyl)methyl]-2-phenylpropanediamide;formic acid |
| SMILES | O=CO.[H]/N=C(\N)c1ccc(NC(=O)C(C(=O)NCc2cccc([N+](=O)[O-])c2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H21N5O4.CH2O2/c24-21(25)17-9-11-18(12-10-17)27-23(30)20(16-6-2-1-3-7-16)22(29)26-14-15-5-4-8-19(13-15)28(31)32;2-1-3/h1-13,20H,14H2,(H3,24,25)(H,26,29)(H,27,30);1H,(H,2,3) |
| InChIKey | ZHEVIPDGCXWUDD-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 188.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.48 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|