C30H27ClN4O5 — CID 162107010
N-(4-carbamimidoylphenyl)-N'-[(2-chloro-6-phenoxyphenyl)methyl]-2-phenylpropanediamide;formic acid (PubChem CID 162107010) has the molecular formula C30H27ClN4O5 and a molecular weight of 559.02 g/mol. Its IUPAC name is N-(4-carbamimidoylphenyl)-N'-[(2-chloro-6-phenoxyphenyl)methyl]-2-phenylpropanediamide;formic acid.
| Compound Name | N-(4-carbamimidoylphenyl)-N'-[(2-chloro-6-phenoxyphenyl)methyl]-2-phenylpropanediamide;formic acid |
|---|---|
| PubChem CID | 162107010 |
| Molecular Formula | C30H27ClN4O5 |
| Molecular Weight | 559.02 g/mol |
| Exact Mass | 558.17 |
| IUPAC Name | N-(4-carbamimidoylphenyl)-N'-[(2-chloro-6-phenoxyphenyl)methyl]-2-phenylpropanediamide;formic acid |
| SMILES | O=CO.[H]/N=C(\N)c1ccc(NC(=O)C(C(=O)NCc2c(Cl)cccc2Oc2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H25ClN4O3.CH2O2/c30-24-12-7-13-25(37-22-10-5-2-6-11-22)23(24)18-33-28(35)26(19-8-3-1-4-9-19)29(36)34-21-16-14-20(15-17-21)27(31)32;2-1-3/h1-17,26H,18H2,(H3,31,32)(H,33,35)(H,34,36);1H,(H,2,3) |
| InChIKey | ZFQIHBREECCTPZ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 154.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.02 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|