C26H19FN4O3S — CID 88883188
2-(3-carbamimidoylphenoxy)-N-[2-fluoro-4-(2-sulfanylphenyl)phenyl]-5-nitrosobenzamide (PubChem CID 88883188) has the molecular formula C26H19FN4O3S and a molecular weight of 486.53 g/mol. Its IUPAC name is 2-(3-carbamimidoylphenoxy)-N-[2-fluoro-4-(2-sulfanylphenyl)phenyl]-5-nitrosobenzamide.
| Compound Name | 2-(3-carbamimidoylphenoxy)-N-[2-fluoro-4-(2-sulfanylphenyl)phenyl]-5-nitrosobenzamide |
|---|---|
| PubChem CID | 88883188 |
| Molecular Formula | C26H19FN4O3S |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | 2-(3-carbamimidoylphenoxy)-N-[2-fluoro-4-(2-sulfanylphenyl)phenyl]-5-nitrosobenzamide |
| SMILES | [H]/N=C(\N)c1cccc(Oc2ccc(N=O)cc2C(=O)Nc2ccc(-c3ccccc3S)cc2F)c1 |
| InChI | InChI=1S/C26H19FN4O3S/c27-21-13-15(19-6-1-2-7-24(19)35)8-10-22(21)30-26(32)20-14-17(31-33)9-11-23(20)34-18-5-3-4-16(12-18)25(28)29/h1-14,35H,(H3,28,29)(H,30,32) |
| InChIKey | HVQFNHBRONMUSZ-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 117.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|