C21H14F2N4O5 — CID 141157229
1-N,3-N-bis(2-fluoro-4-nitrosophenyl)-4-methoxybenzene-1,3-dicarboxamide (PubChem CID 141157229) has the molecular formula C21H14F2N4O5 and a molecular weight of 440.36 g/mol. Its IUPAC name is 1-N,3-N-bis(2-fluoro-4-nitrosophenyl)-4-methoxybenzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis(2-fluoro-4-nitrosophenyl)-4-methoxybenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 141157229 |
| Molecular Formula | C21H14F2N4O5 |
| Molecular Weight | 440.36 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | 1-N,3-N-bis(2-fluoro-4-nitrosophenyl)-4-methoxybenzene-1,3-dicarboxamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(N=O)cc2F)cc1C(=O)Nc1ccc(N=O)cc1F |
| InChI | InChI=1S/C21H14F2N4O5/c1-32-19-7-2-11(20(28)24-17-5-3-12(26-30)9-15(17)22)8-14(19)21(29)25-18-6-4-13(27-31)10-16(18)23/h2-10H,1H3,(H,24,28)(H,25,29) |
| InChIKey | AKOCFCLEXUUYFH-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 126.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.36 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |