C21H14F2N4O7 — CID 141157429
1-N,3-N-bis(3-fluoro-2-nitrophenyl)-4-methoxybenzene-1,3-dicarboxamide (PubChem CID 141157429) has the molecular formula C21H14F2N4O7 and a molecular weight of 472.36 g/mol. Its IUPAC name is 1-N,3-N-bis(3-fluoro-2-nitrophenyl)-4-methoxybenzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis(3-fluoro-2-nitrophenyl)-4-methoxybenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 141157429 |
| Molecular Formula | C21H14F2N4O7 |
| Molecular Weight | 472.36 g/mol |
| Exact Mass | 472.08 |
| IUPAC Name | 1-N,3-N-bis(3-fluoro-2-nitrophenyl)-4-methoxybenzene-1,3-dicarboxamide |
| SMILES | COc1ccc(C(=O)Nc2cccc(F)c2[N+](=O)[O-])cc1C(=O)Nc1cccc(F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C21H14F2N4O7/c1-34-17-9-8-11(20(28)24-15-6-2-4-13(22)18(15)26(30)31)10-12(17)21(29)25-16-7-3-5-14(23)19(16)27(32)33/h2-10H,1H3,(H,24,28)(H,25,29) |
| InChIKey | AXWYXZJQDORSSX-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 153.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.36 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|