C27H24N4O3 — CID 141155439
1-N,3-N-bis(3-cyano-2-ethylphenyl)-4-methoxybenzene-1,3-dicarboxamide (PubChem CID 141155439) has the molecular formula C27H24N4O3 and a molecular weight of 452.51 g/mol. Its IUPAC name is 1-N,3-N-bis(3-cyano-2-ethylphenyl)-4-methoxybenzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis(3-cyano-2-ethylphenyl)-4-methoxybenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 141155439 |
| Molecular Formula | C27H24N4O3 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | 1-N,3-N-bis(3-cyano-2-ethylphenyl)-4-methoxybenzene-1,3-dicarboxamide |
| SMILES | CCc1c(C#N)cccc1NC(=O)c1ccc(OC)c(C(=O)Nc2cccc(C#N)c2CC)c1 |
| InChI | InChI=1S/C27H24N4O3/c1-4-20-18(15-28)8-6-10-23(20)30-26(32)17-12-13-25(34-3)22(14-17)27(33)31-24-11-7-9-19(16-29)21(24)5-2/h6-14H,4-5H2,1-3H3,(H,30,32)(H,31,33) |
| InChIKey | VGIIDEFSSHEBJG-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 115.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |