C23H14F2N4O3 — CID 141157181
1-N,3-N-bis(3-cyano-5-fluorophenyl)-4-methoxybenzene-1,3-dicarboxamide (PubChem CID 141157181) has the molecular formula C23H14F2N4O3 and a molecular weight of 432.39 g/mol. Its IUPAC name is 1-N,3-N-bis(3-cyano-5-fluorophenyl)-4-methoxybenzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis(3-cyano-5-fluorophenyl)-4-methoxybenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 141157181 |
| Molecular Formula | C23H14F2N4O3 |
| Molecular Weight | 432.39 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | 1-N,3-N-bis(3-cyano-5-fluorophenyl)-4-methoxybenzene-1,3-dicarboxamide |
| SMILES | COc1ccc(C(=O)Nc2cc(F)cc(C#N)c2)cc1C(=O)Nc1cc(F)cc(C#N)c1 |
| InChI | InChI=1S/C23H14F2N4O3/c1-32-21-3-2-15(22(30)28-18-6-13(11-26)4-16(24)9-18)8-20(21)23(31)29-19-7-14(12-27)5-17(25)10-19/h2-10H,1H3,(H,28,30)(H,29,31) |
| InChIKey | IAQJBPHCJGGFGD-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 115.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.39 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |