C35H28F2N2O3 — CID 141157198
1-N,3-N-bis(3-benzyl-2-fluorophenyl)-4-methoxybenzene-1,3-dicarboxamide (PubChem CID 141157198) has the molecular formula C35H28F2N2O3 and a molecular weight of 562.62 g/mol. Its IUPAC name is 1-N,3-N-bis(3-benzyl-2-fluorophenyl)-4-methoxybenzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis(3-benzyl-2-fluorophenyl)-4-methoxybenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 141157198 |
| Molecular Formula | C35H28F2N2O3 |
| Molecular Weight | 562.62 g/mol |
| Exact Mass | 562.21 |
| IUPAC Name | 1-N,3-N-bis(3-benzyl-2-fluorophenyl)-4-methoxybenzene-1,3-dicarboxamide |
| SMILES | COc1ccc(C(=O)Nc2cccc(Cc3ccccc3)c2F)cc1C(=O)Nc1cccc(Cc2ccccc2)c1F |
| InChI | InChI=1S/C35H28F2N2O3/c1-42-31-19-18-27(34(40)38-29-16-8-14-25(32(29)36)20-23-10-4-2-5-11-23)22-28(31)35(41)39-30-17-9-15-26(33(30)37)21-24-12-6-3-7-13-24/h2-19,22H,20-21H2,1H3,(H,38,40)(H,39,41) |
| InChIKey | LSVXTXGAPASXHM-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.62 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |