C21H14Cl2F2N2O5 — CID 141157432
1-N,3-N-bis(2-chloro-6-fluoro-4-hydroxyphenyl)-4-methoxybenzene-1,3-dicarboxamide (PubChem CID 141157432) has the molecular formula C21H14Cl2F2N2O5 and a molecular weight of 483.25 g/mol. Its IUPAC name is 1-N,3-N-bis(2-chloro-6-fluoro-4-hydroxyphenyl)-4-methoxybenzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis(2-chloro-6-fluoro-4-hydroxyphenyl)-4-methoxybenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 141157432 |
| Molecular Formula | C21H14Cl2F2N2O5 |
| Molecular Weight | 483.25 g/mol |
| Exact Mass | 482.02 |
| IUPAC Name | 1-N,3-N-bis(2-chloro-6-fluoro-4-hydroxyphenyl)-4-methoxybenzene-1,3-dicarboxamide |
| SMILES | COc1ccc(C(=O)Nc2c(F)cc(O)cc2Cl)cc1C(=O)Nc1c(F)cc(O)cc1Cl |
| InChI | InChI=1S/C21H14Cl2F2N2O5/c1-32-17-3-2-9(20(30)26-18-13(22)5-10(28)7-15(18)24)4-12(17)21(31)27-19-14(23)6-11(29)8-16(19)25/h2-8,28-29H,1H3,(H,26,30)(H,27,31) |
| InChIKey | NLSSYJMALBVPHX-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.25 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|