C21H12Cl2F2N4O5 — CID 141157200
1-N,3-N-bis(2-chloro-6-fluoro-4-nitrosophenyl)-4-methoxybenzene-1,3-dicarboxamide (PubChem CID 141157200) has the molecular formula C21H12Cl2F2N4O5 and a molecular weight of 509.25 g/mol. Its IUPAC name is 1-N,3-N-bis(2-chloro-6-fluoro-4-nitrosophenyl)-4-methoxybenzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis(2-chloro-6-fluoro-4-nitrosophenyl)-4-methoxybenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 141157200 |
| Molecular Formula | C21H12Cl2F2N4O5 |
| Molecular Weight | 509.25 g/mol |
| Exact Mass | 508.02 |
| IUPAC Name | 1-N,3-N-bis(2-chloro-6-fluoro-4-nitrosophenyl)-4-methoxybenzene-1,3-dicarboxamide |
| SMILES | COc1ccc(C(=O)Nc2c(F)cc(N=O)cc2Cl)cc1C(=O)Nc1c(F)cc(N=O)cc1Cl |
| InChI | InChI=1S/C21H12Cl2F2N4O5/c1-34-17-3-2-9(20(30)26-18-13(22)5-10(28-32)7-15(18)24)4-12(17)21(31)27-19-14(23)6-11(29-33)8-16(19)25/h2-8H,1H3,(H,26,30)(H,27,31) |
| InChIKey | ZZLLRKHVFZUTHF-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 126.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.25 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |