C20H15F3N2O3S — CID 71086559
2-sulfamoyl-N-[4-[3-(trifluoromethyl)phenyl]phenyl]benzamide (PubChem CID 71086559) has the molecular formula C20H15F3N2O3S and a molecular weight of 420.41 g/mol. Its IUPAC name is 2-sulfamoyl-N-[4-[3-(trifluoromethyl)phenyl]phenyl]benzamide.
| Compound Name | 2-sulfamoyl-N-[4-[3-(trifluoromethyl)phenyl]phenyl]benzamide |
|---|---|
| PubChem CID | 71086559 |
| Molecular Formula | C20H15F3N2O3S |
| Molecular Weight | 420.41 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | 2-sulfamoyl-N-[4-[3-(trifluoromethyl)phenyl]phenyl]benzamide |
| SMILES | NS(=O)(=O)c1ccccc1C(=O)Nc1ccc(-c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C20H15F3N2O3S/c21-20(22,23)15-5-3-4-14(12-15)13-8-10-16(11-9-13)25-19(26)17-6-1-2-7-18(17)29(24,27)28/h1-12H,(H,25,26)(H2,24,27,28) |
| InChIKey | WIWPRPIRKCJRMG-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.41 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |