C30H23N3O5S — CID 66831445
3-naphthalen-1-yloxy-2-[[4-(2-sulfamoylphenyl)benzoyl]amino]benzamide (PubChem CID 66831445) has the molecular formula C30H23N3O5S and a molecular weight of 537.60 g/mol. Its IUPAC name is 3-naphthalen-1-yloxy-2-[[4-(2-sulfamoylphenyl)benzoyl]amino]benzamide.
| Compound Name | 3-naphthalen-1-yloxy-2-[[4-(2-sulfamoylphenyl)benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 66831445 |
| Molecular Formula | C30H23N3O5S |
| Molecular Weight | 537.60 g/mol |
| Exact Mass | 537.14 |
| IUPAC Name | 3-naphthalen-1-yloxy-2-[[4-(2-sulfamoylphenyl)benzoyl]amino]benzamide |
| SMILES | NC(=O)c1cccc(Oc2cccc3ccccc23)c1NC(=O)c1ccc(-c2ccccc2S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C30H23N3O5S/c31-29(34)24-11-6-13-26(38-25-12-5-8-19-7-1-2-9-22(19)25)28(24)33-30(35)21-17-15-20(16-18-21)23-10-3-4-14-27(23)39(32,36)37/h1-18H,(H2,31,34)(H,33,35)(H2,32,36,37) |
| InChIKey | YXLFBGFGFJCMIS-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 141.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.60 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |