C35H39F3N4O5S — CID 143133230
3-benzamido-4-[4-(fluoromethyl)anilino]-N-[2-(hexanoylsulfamoyl)phenyl]benzamide;fluoromethane (PubChem CID 143133230) has the molecular formula C35H39F3N4O5S and a molecular weight of 684.78 g/mol. Its IUPAC name is 3-benzamido-4-[4-(fluoromethyl)anilino]-N-[2-(hexanoylsulfamoyl)phenyl]benzamide;fluoromethane.
| Compound Name | 3-benzamido-4-[4-(fluoromethyl)anilino]-N-[2-(hexanoylsulfamoyl)phenyl]benzamide;fluoromethane |
|---|---|
| PubChem CID | 143133230 |
| Molecular Formula | C35H39F3N4O5S |
| Molecular Weight | 684.78 g/mol |
| Exact Mass | 684.26 |
| IUPAC Name | 3-benzamido-4-[4-(fluoromethyl)anilino]-N-[2-(hexanoylsulfamoyl)phenyl]benzamide;fluoromethane |
| SMILES | CCCCCC(=O)NS(=O)(=O)c1ccccc1NC(=O)c1ccc(Nc2ccc(CF)cc2)c(NC(=O)c2ccccc2)c1.CF.CF |
| InChI | InChI=1S/C33H33FN4O5S.2CH3F/c1-2-3-5-14-31(39)38-44(42,43)30-13-9-8-12-28(30)36-33(41)25-17-20-27(35-26-18-15-23(22-34)16-19-26)29(21-25)37-32(40)24-10-6-4-7-11-24;2*1-2/h4,6-13,15-21,35H,2-3,5,14,22H2,1H3,(H,36,41)(H,37,40)(H,38,39);2*1H3 |
| InChIKey | WKFYMVANWYLCTG-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 133.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.78 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|