C28H25F3N4O4S2 — CID 142263841
N-[2-(hexanoylsulfamoyl)phenyl]-6-[4-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]pyridine-3-carboxamide (PubChem CID 142263841) has the molecular formula C28H25F3N4O4S2 and a molecular weight of 602.66 g/mol. Its IUPAC name is N-[2-(hexanoylsulfamoyl)phenyl]-6-[4-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]pyridine-3-carboxamide.
| Compound Name | N-[2-(hexanoylsulfamoyl)phenyl]-6-[4-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 142263841 |
| Molecular Formula | C28H25F3N4O4S2 |
| Molecular Weight | 602.66 g/mol |
| Exact Mass | 602.13 |
| IUPAC Name | N-[2-(hexanoylsulfamoyl)phenyl]-6-[4-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]pyridine-3-carboxamide |
| SMILES | CCCCCC(=O)NS(=O)(=O)c1ccccc1NC(=O)c1ccc(-c2nc(-c3ccc(C(F)(F)F)cc3)cs2)nc1 |
| InChI | InChI=1S/C28H25F3N4O4S2/c1-2-3-4-9-25(36)35-41(38,39)24-8-6-5-7-21(24)33-26(37)19-12-15-22(32-16-19)27-34-23(17-40-27)18-10-13-20(14-11-18)28(29,30)31/h5-8,10-17H,2-4,9H2,1H3,(H,33,37)(H,35,36) |
| InChIKey | OKUWHMWRMQZRKY-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.66 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|